C46H82N2O5 — CID 88888759
2-[6-aminohexanoyl-[2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyethyl]amino]ethyl (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 88888759) has the molecular formula C46H82N2O5 and a molecular weight of 743.17 g/mol. Its IUPAC name is 2-[6-aminohexanoyl-[2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyethyl]amino]ethyl (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | 2-[6-aminohexanoyl-[2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyethyl]amino]ethyl (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 88888759 |
| Molecular Formula | C46H82N2O5 |
| Molecular Weight | 743.17 g/mol |
| Exact Mass | 742.62 |
| IUPAC Name | 2-[6-aminohexanoyl-[2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyethyl]amino]ethyl (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCCN(CCOC(=O)CCCCCCC/C=C\C/C=C\CCCCC)C(=O)CCCCCN |
| InChI | InChI=1S/C46H82N2O5/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-33-37-45(50)52-42-40-48(44(49)36-32-31-35-39-47)41-43-53-46(51)38-34-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20H,3-10,15-16,21-43,47H2,1-2H3/b13-11-,14-12-,19-17-,20-18- |
| InChIKey | RICMBAKPXKUNSB-MAZCIEHSSA-N |
| XLogP | 12.05 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.17 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|