C44H80N2O3 — CID 139565762
[3-[bis[(9Z,12Z)-octadeca-9,12-dienyl]amino]-3-oxopropyl] 5-aminopentanoate (PubChem CID 139565762) has the molecular formula C44H80N2O3 and a molecular weight of 685.13 g/mol. Its IUPAC name is [3-[bis[(9Z,12Z)-octadeca-9,12-dienyl]amino]-3-oxopropyl] 5-aminopentanoate.
| Compound Name | [3-[bis[(9Z,12Z)-octadeca-9,12-dienyl]amino]-3-oxopropyl] 5-aminopentanoate |
|---|---|
| PubChem CID | 139565762 |
| Molecular Formula | C44H80N2O3 |
| Molecular Weight | 685.13 g/mol |
| Exact Mass | 684.62 |
| IUPAC Name | [3-[bis[(9Z,12Z)-octadeca-9,12-dienyl]amino]-3-oxopropyl] 5-aminopentanoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCN(CCCCCCCC/C=C\C/C=C\CCCCC)C(=O)CCOC(=O)CCCCN |
| InChI | InChI=1S/C44H80N2O3/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-35-40-46(43(47)38-42-49-44(48)37-33-34-39-45)41-36-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20H,3-10,15-16,21-42,45H2,1-2H3/b13-11-,14-12-,19-17-,20-18- |
| InChIKey | BUBBRMRIZLACKS-MAZCIEHSSA-N |
| XLogP | 12.50 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.13 |
| LogP ≤ 5 | 12.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|