C40H74N2O5S — CID 118084758
[(Z)-undec-2-enyl] 6-[[2-[2-(dimethylamino)ethylsulfanyl]acetyl]-[6-oxo-6-[(E)-undec-2-enoxy]hexyl]amino]hexanoate (PubChem CID 118084758) has the molecular formula C40H74N2O5S and a molecular weight of 695.11 g/mol. Its IUPAC name is [(Z)-undec-2-enyl] 6-[[2-[2-(dimethylamino)ethylsulfanyl]acetyl]-[6-oxo-6-[(E)-undec-2-enoxy]hexyl]amino]hexanoate.
| Compound Name | [(Z)-undec-2-enyl] 6-[[2-[2-(dimethylamino)ethylsulfanyl]acetyl]-[6-oxo-6-[(E)-undec-2-enoxy]hexyl]amino]hexanoate |
|---|---|
| PubChem CID | 118084758 |
| Molecular Formula | C40H74N2O5S |
| Molecular Weight | 695.11 g/mol |
| Exact Mass | 694.53 |
| IUPAC Name | [(Z)-undec-2-enyl] 6-[[2-[2-(dimethylamino)ethylsulfanyl]acetyl]-[6-oxo-6-[(E)-undec-2-enoxy]hexyl]amino]hexanoate |
| SMILES | CCCCCCCC/C=C\COC(=O)CCCCCN(CCCCCC(=O)OC/C=C/CCCCCCCC)C(=O)CSCCN(C)C |
| InChI | InChI=1S/C40H74N2O5S/c1-5-7-9-11-13-15-17-19-27-34-46-39(44)29-23-21-25-31-42(38(43)37-48-36-33-41(3)4)32-26-22-24-30-40(45)47-35-28-20-18-16-14-12-10-8-6-2/h19-20,27-28H,5-18,21-26,29-37H2,1-4H3/b27-19-,28-20+ |
| InChIKey | ZQGSBXHRQJOUQI-RIRMOVKSSA-N |
| XLogP | 9.93 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.11 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|