C29H52N2O5S — CID 138657805
2-[[2-[2-(dimethylamino)ethylsulfanyl]acetyl]-(2-formyloxyethyl)amino]ethyl (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 138657805) has the molecular formula C29H52N2O5S and a molecular weight of 540.81 g/mol. Its IUPAC name is 2-[[2-[2-(dimethylamino)ethylsulfanyl]acetyl]-(2-formyloxyethyl)amino]ethyl (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | 2-[[2-[2-(dimethylamino)ethylsulfanyl]acetyl]-(2-formyloxyethyl)amino]ethyl (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 138657805 |
| Molecular Formula | C29H52N2O5S |
| Molecular Weight | 540.81 g/mol |
| Exact Mass | 540.36 |
| IUPAC Name | 2-[[2-[2-(dimethylamino)ethylsulfanyl]acetyl]-(2-formyloxyethyl)amino]ethyl (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCCN(CCOC=O)C(=O)CSCCN(C)C |
| InChI | InChI=1S/C29H52N2O5S/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-29(34)36-24-21-31(20-23-35-27-32)28(33)26-37-25-22-30(2)3/h8-9,11-12,27H,4-7,10,13-26H2,1-3H3/b9-8-,12-11- |
| InChIKey | XCMURWYQJBKTDN-MURFETPASA-N |
| XLogP | 5.64 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.81 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|