C45H80N2O5S — CID 123323673
2-[2-(dimethylamino)ethylsulfanylcarbonyl-(2-octadeca-9,12-dienoyloxyethyl)amino]ethyl octadeca-9,12-dienoate (PubChem CID 123323673) has the molecular formula C45H80N2O5S and a molecular weight of 761.21 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethylsulfanylcarbonyl-(2-octadeca-9,12-dienoyloxyethyl)amino]ethyl octadeca-9,12-dienoate.
| Compound Name | 2-[2-(dimethylamino)ethylsulfanylcarbonyl-(2-octadeca-9,12-dienoyloxyethyl)amino]ethyl octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 123323673 |
| Molecular Formula | C45H80N2O5S |
| Molecular Weight | 761.21 g/mol |
| Exact Mass | 760.58 |
| IUPAC Name | 2-[2-(dimethylamino)ethylsulfanylcarbonyl-(2-octadeca-9,12-dienoyloxyethyl)amino]ethyl octadeca-9,12-dienoate |
| SMILES | CCCCCC=CCC=CCCCCCCCC(=O)OCCN(CCOC(=O)CCCCCCCC=CCC=CCCCCC)C(=O)SCCN(C)C |
| InChI | InChI=1S/C45H80N2O5S/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-43(48)51-40-37-47(45(50)53-42-39-46(3)4)38-41-52-44(49)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22H,5-12,17-18,23-42H2,1-4H3 |
| InChIKey | FJMJSZIIJUBBOO-UHFFFAOYSA-N |
| XLogP | 12.42 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.21 |
| LogP ≤ 5 | 12.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|