C46H88N2O5S — CID 135130503
[(Z)-non-2-enyl] 8-[2-(dimethylamino)ethylsulfanylcarbonyl-(8-hexadecan-8-yloxy-8-oxooctyl)amino]octanoate (PubChem CID 135130503) has the molecular formula C46H88N2O5S and a molecular weight of 781.29 g/mol. Its IUPAC name is [(Z)-non-2-enyl] 8-[2-(dimethylamino)ethylsulfanylcarbonyl-(8-hexadecan-8-yloxy-8-oxooctyl)amino]octanoate.
| Compound Name | [(Z)-non-2-enyl] 8-[2-(dimethylamino)ethylsulfanylcarbonyl-(8-hexadecan-8-yloxy-8-oxooctyl)amino]octanoate |
|---|---|
| PubChem CID | 135130503 |
| Molecular Formula | C46H88N2O5S |
| Molecular Weight | 781.29 g/mol |
| Exact Mass | 780.64 |
| IUPAC Name | [(Z)-non-2-enyl] 8-[2-(dimethylamino)ethylsulfanylcarbonyl-(8-hexadecan-8-yloxy-8-oxooctyl)amino]octanoate |
| SMILES | CCCCCC/C=C\COC(=O)CCCCCCCN(CCCCCCCC(=O)OC(CCCCCCC)CCCCCCCC)C(=O)SCCN(C)C |
| InChI | InChI=1S/C46H88N2O5S/c1-6-9-12-15-17-26-33-41-52-44(49)36-29-22-18-24-31-38-48(46(51)54-42-40-47(4)5)39-32-25-19-23-30-37-45(50)53-43(34-27-20-14-11-8-3)35-28-21-16-13-10-7-2/h26,33,43H,6-25,27-32,34-42H2,1-5H3/b33-26- |
| InChIKey | XGOHQZDUNCUDPI-MKFPQRGTSA-N |
| XLogP | 13.48 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.29 |
| LogP ≤ 5 | 13.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|