C32H58N2O4S — CID 174175157
[(4E,11E)-pentadeca-4,11-dien-8-yl] 6-[2-(dimethylamino)ethylsulfanylcarbonyl-(6-oxohexyl)amino]hexanoate (PubChem CID 174175157) has the molecular formula C32H58N2O4S and a molecular weight of 566.89 g/mol. Its IUPAC name is [(4E,11E)-pentadeca-4,11-dien-8-yl] 6-[2-(dimethylamino)ethylsulfanylcarbonyl-(6-oxohexyl)amino]hexanoate.
| Compound Name | [(4E,11E)-pentadeca-4,11-dien-8-yl] 6-[2-(dimethylamino)ethylsulfanylcarbonyl-(6-oxohexyl)amino]hexanoate |
|---|---|
| PubChem CID | 174175157 |
| Molecular Formula | C32H58N2O4S |
| Molecular Weight | 566.89 g/mol |
| Exact Mass | 566.41 |
| IUPAC Name | [(4E,11E)-pentadeca-4,11-dien-8-yl] 6-[2-(dimethylamino)ethylsulfanylcarbonyl-(6-oxohexyl)amino]hexanoate |
| SMILES | CCC/C=C/CCC(CC/C=C/CCC)OC(=O)CCCCCN(CCCCCC=O)C(=O)SCCN(C)C |
| InChI | InChI=1S/C32H58N2O4S/c1-5-7-9-11-16-22-30(23-17-12-10-8-6-2)38-31(36)24-18-15-20-26-34(25-19-13-14-21-28-35)32(37)39-29-27-33(3)4/h9-12,28,30H,5-8,13-27,29H2,1-4H3/b11-9+,12-10+ |
| InChIKey | DNBKNDQOGYDRCU-WGDLNXRISA-N |
| XLogP | 8.21 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.89 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|