C39H72N2O5S — CID 123902267
methyl 16-[2-(dimethylamino)ethylsulfanylcarbonyl-(16-methoxy-16-oxohexadec-9-enyl)amino]hexadec-7-enoate (PubChem CID 123902267) has the molecular formula C39H72N2O5S and a molecular weight of 681.08 g/mol. Its IUPAC name is methyl 16-[2-(dimethylamino)ethylsulfanylcarbonyl-(16-methoxy-16-oxohexadec-9-enyl)amino]hexadec-7-enoate.
| Compound Name | methyl 16-[2-(dimethylamino)ethylsulfanylcarbonyl-(16-methoxy-16-oxohexadec-9-enyl)amino]hexadec-7-enoate |
|---|---|
| PubChem CID | 123902267 |
| Molecular Formula | C39H72N2O5S |
| Molecular Weight | 681.08 g/mol |
| Exact Mass | 680.52 |
| IUPAC Name | methyl 16-[2-(dimethylamino)ethylsulfanylcarbonyl-(16-methoxy-16-oxohexadec-9-enyl)amino]hexadec-7-enoate |
| SMILES | COC(=O)CCCCCC=CCCCCCCCCN(CCCCCCCCC=CCCCCCC(=O)OC)C(=O)SCCN(C)C |
| InChI | InChI=1S/C39H72N2O5S/c1-40(2)35-36-47-39(44)41(33-29-25-21-17-13-9-5-7-11-15-19-23-27-31-37(42)45-3)34-30-26-22-18-14-10-6-8-12-16-20-24-28-32-38(43)46-4/h7-8,11-12H,5-6,9-10,13-36H2,1-4H3 |
| InChIKey | AGPVBQLOZHPKOB-UHFFFAOYSA-N |
| XLogP | 10.52 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.08 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|