C41H68N2O5S — CID 130187752
[(Z)-non-2-enyl] 8-[2-(dimethylamino)ethylsulfanylcarbonyl-[[3-[3-[(Z)-non-2-enoxy]-3-oxopropyl]phenyl]methyl]amino]octanoate (PubChem CID 130187752) has the molecular formula C41H68N2O5S and a molecular weight of 701.07 g/mol. Its IUPAC name is [(Z)-non-2-enyl] 8-[2-(dimethylamino)ethylsulfanylcarbonyl-[[3-[3-[(Z)-non-2-enoxy]-3-oxopropyl]phenyl]methyl]amino]octanoate.
| Compound Name | [(Z)-non-2-enyl] 8-[2-(dimethylamino)ethylsulfanylcarbonyl-[[3-[3-[(Z)-non-2-enoxy]-3-oxopropyl]phenyl]methyl]amino]octanoate |
|---|---|
| PubChem CID | 130187752 |
| Molecular Formula | C41H68N2O5S |
| Molecular Weight | 701.07 g/mol |
| Exact Mass | 700.48 |
| IUPAC Name | [(Z)-non-2-enyl] 8-[2-(dimethylamino)ethylsulfanylcarbonyl-[[3-[3-[(Z)-non-2-enoxy]-3-oxopropyl]phenyl]methyl]amino]octanoate |
| SMILES | CCCCCC/C=C\COC(=O)CCCCCCCN(Cc1cccc(CCC(=O)OC/C=C\CCCCCC)c1)C(=O)SCCN(C)C |
| InChI | InChI=1S/C41H68N2O5S/c1-5-7-9-11-13-18-22-32-47-39(44)27-20-16-15-17-21-30-43(41(46)49-34-31-42(3)4)36-38-26-24-25-37(35-38)28-29-40(45)48-33-23-19-14-12-10-8-6-2/h18-19,22-26,35H,5-17,20-21,27-34,36H2,1-4H3/b22-18-,23-19- |
| InChIKey | OVJSSXVNQHHTJT-RSFSRFMPSA-N |
| XLogP | 10.32 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.07 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|