C44H76N2O5S — CID 156647284
[(Z)-non-2-enyl] 4-[3-[2-(dimethylamino)ethylsulfanylcarbonyl-[8-[(Z)-non-2-enoxy]-8-oxooctyl]amino]propyl]benzoate;propane (PubChem CID 156647284) has the molecular formula C44H76N2O5S and a molecular weight of 745.17 g/mol. Its IUPAC name is [(Z)-non-2-enyl] 4-[3-[2-(dimethylamino)ethylsulfanylcarbonyl-[8-[(Z)-non-2-enoxy]-8-oxooctyl]amino]propyl]benzoate;propane.
| Compound Name | [(Z)-non-2-enyl] 4-[3-[2-(dimethylamino)ethylsulfanylcarbonyl-[8-[(Z)-non-2-enoxy]-8-oxooctyl]amino]propyl]benzoate;propane |
|---|---|
| PubChem CID | 156647284 |
| Molecular Formula | C44H76N2O5S |
| Molecular Weight | 745.17 g/mol |
| Exact Mass | 744.55 |
| IUPAC Name | [(Z)-non-2-enyl] 4-[3-[2-(dimethylamino)ethylsulfanylcarbonyl-[8-[(Z)-non-2-enoxy]-8-oxooctyl]amino]propyl]benzoate;propane |
| SMILES | CCC.CCCCCC/C=C\COC(=O)CCCCCCCN(CCCc1ccc(C(=O)OC/C=C\CCCCCC)cc1)C(=O)SCCN(C)C |
| InChI | InChI=1S/C41H68N2O5S.C3H8/c1-5-7-9-11-13-18-22-34-47-39(44)26-20-16-15-17-21-31-43(41(46)49-36-33-42(3)4)32-24-25-37-27-29-38(30-28-37)40(45)48-35-23-19-14-12-10-8-6-2;1-3-2/h18-19,22-23,27-30H,5-17,20-21,24-26,31-36H2,1-4H3;3H2,1-2H3/b22-18-,23-19-; |
| InChIKey | QDUCCRYGGSIUCN-WXHPZBCZSA-N |
| XLogP | 11.85 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.17 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|