C62H118N2O7 — CID 171658621
1-O-[2-[[4-(dimethylamino)butyl-nonanoylamino]methyl]-3-[(Z)-octadec-9-enoyl]oxypropyl] 8-O-heptadecan-9-yl octanedioate (PubChem CID 171658621) has the molecular formula C62H118N2O7 and a molecular weight of 1003.63 g/mol. Its IUPAC name is 1-O-[2-[[4-(dimethylamino)butyl-nonanoylamino]methyl]-3-[(Z)-octadec-9-enoyl]oxypropyl] 8-O-heptadecan-9-yl octanedioate.
| Compound Name | 1-O-[2-[[4-(dimethylamino)butyl-nonanoylamino]methyl]-3-[(Z)-octadec-9-enoyl]oxypropyl] 8-O-heptadecan-9-yl octanedioate |
|---|---|
| PubChem CID | 171658621 |
| Molecular Formula | C62H118N2O7 |
| Molecular Weight | 1003.63 g/mol |
| Exact Mass | 1002.89 |
| IUPAC Name | 1-O-[2-[[4-(dimethylamino)butyl-nonanoylamino]methyl]-3-[(Z)-octadec-9-enoyl]oxypropyl] 8-O-heptadecan-9-yl octanedioate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(COC(=O)CCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)CN(CCCCN(C)C)C(=O)CCCCCCCC |
| InChI | InChI=1S/C62H118N2O7/c1-7-11-15-19-23-24-25-26-27-28-29-30-31-35-41-49-60(66)69-55-57(54-64(53-45-44-52-63(5)6)59(65)48-40-34-22-18-14-10-4)56-70-61(67)50-42-36-37-43-51-62(68)71-58(46-38-32-20-16-12-8-2)47-39-33-21-17-13-9-3/h26-27,57-58H,7-25,28-56H2,1-6H3/b27-26- |
| InChIKey | IQVWHSGMGWRHCH-RQZHXJHFSA-N |
| XLogP | 17.40 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 55 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1003.63 |
| LogP ≤ 5 | 17.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|