C63H120N2O9 — CID 171658989
1-O-[2-[[3-(dimethylamino)propyl-octanoylamino]methyl]-3-(8-oxo-8-pentadecan-7-yloxyoctanoyl)oxypropyl] 8-O-pentadecan-7-yl octanedioate (PubChem CID 171658989) has the molecular formula C63H120N2O9 and a molecular weight of 1049.66 g/mol. Its IUPAC name is 1-O-[2-[[3-(dimethylamino)propyl-octanoylamino]methyl]-3-(8-oxo-8-pentadecan-7-yloxyoctanoyl)oxypropyl] 8-O-pentadecan-7-yl octanedioate.
| Compound Name | 1-O-[2-[[3-(dimethylamino)propyl-octanoylamino]methyl]-3-(8-oxo-8-pentadecan-7-yloxyoctanoyl)oxypropyl] 8-O-pentadecan-7-yl octanedioate |
|---|---|
| PubChem CID | 171658989 |
| Molecular Formula | C63H120N2O9 |
| Molecular Weight | 1049.66 g/mol |
| Exact Mass | 1048.90 |
| IUPAC Name | 1-O-[2-[[3-(dimethylamino)propyl-octanoylamino]methyl]-3-(8-oxo-8-pentadecan-7-yloxyoctanoyl)oxypropyl] 8-O-pentadecan-7-yl octanedioate |
| SMILES | CCCCCCCCC(CCCCCC)OC(=O)CCCCCCC(=O)OCC(COC(=O)CCCCCCC(=O)OC(CCCCCC)CCCCCCCC)CN(CCCN(C)C)C(=O)CCCCCCC |
| InChI | InChI=1S/C63H120N2O9/c1-8-13-18-23-26-34-44-57(42-32-21-16-11-4)73-62(69)49-39-30-28-37-47-60(67)71-54-56(53-65(52-41-51-64(6)7)59(66)46-36-25-20-15-10-3)55-72-61(68)48-38-29-31-40-50-63(70)74-58(43-33-22-17-12-5)45-35-27-24-19-14-9-2/h56-58H,8-55H2,1-7H3 |
| InChIKey | TZTARPNYAOPXSF-UHFFFAOYSA-N |
| XLogP | 16.78 |
| TPSA | 128.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 56 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1049.66 |
| LogP ≤ 5 | 16.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|