C55H106N2O8 — CID 175624395
8-O-[1-[8-(dioctylamino)-8-oxooctanoyl]oxy-3-[2-hydroxyethyl(methyl)amino]propan-2-yl] 1-O-heptadecan-9-yl octanedioate (PubChem CID 175624395) has the molecular formula C55H106N2O8 and a molecular weight of 923.46 g/mol. Its IUPAC name is 8-O-[1-[8-(dioctylamino)-8-oxooctanoyl]oxy-3-[2-hydroxyethyl(methyl)amino]propan-2-yl] 1-O-heptadecan-9-yl octanedioate.
| Compound Name | 8-O-[1-[8-(dioctylamino)-8-oxooctanoyl]oxy-3-[2-hydroxyethyl(methyl)amino]propan-2-yl] 1-O-heptadecan-9-yl octanedioate |
|---|---|
| PubChem CID | 175624395 |
| Molecular Formula | C55H106N2O8 |
| Molecular Weight | 923.46 g/mol |
| Exact Mass | 922.79 |
| IUPAC Name | 8-O-[1-[8-(dioctylamino)-8-oxooctanoyl]oxy-3-[2-hydroxyethyl(methyl)amino]propan-2-yl] 1-O-heptadecan-9-yl octanedioate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCC(=O)OC(COC(=O)CCCCCCC(=O)N(CCCCCCCC)CCCCCCCC)CN(C)CCO |
| InChI | InChI=1S/C55H106N2O8/c1-6-10-14-18-22-30-38-50(39-31-23-19-15-11-7-2)64-54(61)42-34-26-27-35-43-55(62)65-51(48-56(5)46-47-58)49-63-53(60)41-33-25-24-32-40-52(59)57(44-36-28-20-16-12-8-3)45-37-29-21-17-13-9-4/h50-51,58H,6-49H2,1-5H3 |
| InChIKey | ALEVQRRAVILAMU-UHFFFAOYSA-N |
| XLogP | 14.01 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 923.46 |
| LogP ≤ 5 | 14.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|