C37H71NO7 — CID 168857824
2-hexyloctyl 6-[2,3-di(hexanoyloxy)propyl-(2-hydroxyethyl)amino]hexanoate (PubChem CID 168857824) has the molecular formula C37H71NO7 and a molecular weight of 641.98 g/mol. Its IUPAC name is 2-hexyloctyl 6-[2,3-di(hexanoyloxy)propyl-(2-hydroxyethyl)amino]hexanoate.
| Compound Name | 2-hexyloctyl 6-[2,3-di(hexanoyloxy)propyl-(2-hydroxyethyl)amino]hexanoate |
|---|---|
| PubChem CID | 168857824 |
| Molecular Formula | C37H71NO7 |
| Molecular Weight | 641.98 g/mol |
| Exact Mass | 641.52 |
| IUPAC Name | 2-hexyloctyl 6-[2,3-di(hexanoyloxy)propyl-(2-hydroxyethyl)amino]hexanoate |
| SMILES | CCCCCCC(CCCCCC)COC(=O)CCCCCN(CCO)CC(COC(=O)CCCCC)OC(=O)CCCCC |
| InChI | InChI=1S/C37H71NO7/c1-5-9-13-18-22-33(23-19-14-10-6-2)31-43-35(40)25-20-15-21-27-38(28-29-39)30-34(45-37(42)26-17-12-8-4)32-44-36(41)24-16-11-7-3/h33-34,39H,5-32H2,1-4H3 |
| InChIKey | GQLXPTXSJPRUHK-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.98 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|