C48H91NO10 — CID 175626060
[6-[1-[bis(2-hydroxyethyl)amino]-3-[6-(2-pentylnonanoyloxy)hexanoyloxy]propan-2-yl]oxy-6-oxohexyl] 2-hexylnonanoate (PubChem CID 175626060) has the molecular formula C48H91NO10 and a molecular weight of 842.25 g/mol. Its IUPAC name is [6-[1-[bis(2-hydroxyethyl)amino]-3-[6-(2-pentylnonanoyloxy)hexanoyloxy]propan-2-yl]oxy-6-oxohexyl] 2-hexylnonanoate.
| Compound Name | [6-[1-[bis(2-hydroxyethyl)amino]-3-[6-(2-pentylnonanoyloxy)hexanoyloxy]propan-2-yl]oxy-6-oxohexyl] 2-hexylnonanoate |
|---|---|
| PubChem CID | 175626060 |
| Molecular Formula | C48H91NO10 |
| Molecular Weight | 842.25 g/mol |
| Exact Mass | 841.66 |
| IUPAC Name | [6-[1-[bis(2-hydroxyethyl)amino]-3-[6-(2-pentylnonanoyloxy)hexanoyloxy]propan-2-yl]oxy-6-oxohexyl] 2-hexylnonanoate |
| SMILES | CCCCCCCC(CCCCC)C(=O)OCCCCCC(=O)OCC(CN(CCO)CCO)OC(=O)CCCCCOC(=O)C(CCCCCC)CCCCCCC |
| InChI | InChI=1S/C48H91NO10/c1-5-9-13-16-22-30-42(28-20-12-8-4)47(54)56-38-26-18-24-32-45(52)58-41-44(40-49(34-36-50)35-37-51)59-46(53)33-25-19-27-39-57-48(55)43(29-21-15-11-7-3)31-23-17-14-10-6-2/h42-44,50-51H,5-41H2,1-4H3 |
| InChIKey | NJXWVCREPJAQAY-UHFFFAOYSA-N |
| XLogP | 10.44 |
| TPSA | 148.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.25 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|