C45H85NO8 — CID 175624172
[4-[3-(dimethylamino)-2-[4-(2-hexyldecanoyloxy)butanoyloxy]propoxy]-4-oxobutyl] 2-hexyldecanoate (PubChem CID 175624172) has the molecular formula C45H85NO8 and a molecular weight of 768.17 g/mol. Its IUPAC name is [4-[3-(dimethylamino)-2-[4-(2-hexyldecanoyloxy)butanoyloxy]propoxy]-4-oxobutyl] 2-hexyldecanoate.
| Compound Name | [4-[3-(dimethylamino)-2-[4-(2-hexyldecanoyloxy)butanoyloxy]propoxy]-4-oxobutyl] 2-hexyldecanoate |
|---|---|
| PubChem CID | 175624172 |
| Molecular Formula | C45H85NO8 |
| Molecular Weight | 768.17 g/mol |
| Exact Mass | 767.63 |
| IUPAC Name | [4-[3-(dimethylamino)-2-[4-(2-hexyldecanoyloxy)butanoyloxy]propoxy]-4-oxobutyl] 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCCC(=O)OCC(CN(C)C)OC(=O)CCCOC(=O)C(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C45H85NO8/c1-7-11-15-19-21-25-31-39(29-23-17-13-9-3)44(49)51-35-27-33-42(47)53-38-41(37-46(5)6)54-43(48)34-28-36-52-45(50)40(30-24-18-14-10-4)32-26-22-20-16-12-8-2/h39-41H,7-38H2,1-6H3 |
| InChIKey | FZUXULLHJSVOCD-UHFFFAOYSA-N |
| XLogP | 11.32 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.17 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|