C48H95NO8 — CID 175624061
[6-[3-(dimethylamino)-2-(1-hydroxy-6-oxo-6-pentadecan-7-yloxyhexoxy)propoxy]-6-hydroxyhexyl] 2-hexyldecanoate (PubChem CID 175624061) has the molecular formula C48H95NO8 and a molecular weight of 814.29 g/mol. Its IUPAC name is [6-[3-(dimethylamino)-2-(1-hydroxy-6-oxo-6-pentadecan-7-yloxyhexoxy)propoxy]-6-hydroxyhexyl] 2-hexyldecanoate.
| Compound Name | [6-[3-(dimethylamino)-2-(1-hydroxy-6-oxo-6-pentadecan-7-yloxyhexoxy)propoxy]-6-hydroxyhexyl] 2-hexyldecanoate |
|---|---|
| PubChem CID | 175624061 |
| Molecular Formula | C48H95NO8 |
| Molecular Weight | 814.29 g/mol |
| Exact Mass | 813.71 |
| IUPAC Name | [6-[3-(dimethylamino)-2-(1-hydroxy-6-oxo-6-pentadecan-7-yloxyhexoxy)propoxy]-6-hydroxyhexyl] 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)OC(=O)CCCCC(O)OC(COC(O)CCCCCOC(=O)C(CCCCCC)CCCCCCCC)CN(C)C |
| InChI | InChI=1S/C48H95NO8/c1-7-11-15-19-21-25-33-42(32-24-17-13-9-3)48(53)54-39-31-23-28-36-45(50)55-41-44(40-49(5)6)57-47(52)38-30-29-37-46(51)56-43(34-26-18-14-10-4)35-27-22-20-16-12-8-2/h42-45,47,50,52H,7-41H2,1-6H3 |
| InChIKey | MZGPDYPQFBOPIZ-UHFFFAOYSA-N |
| XLogP | 12.22 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.29 |
| LogP ≤ 5 | 12.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|