About 1-O-[3-(dimethylamino)-2-hydroxypropyl] 6-O-hexadecan-7-yl hexanedioate
1-O-[3-(dimethylamino)-2-hydroxypropyl] 6-O-hexadecan-7-yl hexanedioate (PubChem CID 175624907) has the molecular formula C27H53NO5
and a molecular weight of 471.72 g/mol. Its IUPAC name is 1-O-[3-(dimethylamino)-2-hydroxypropyl] 6-O-hexadecan-7-yl hexanedioate.
Molecular Properties
| Compound Name | 1-O-[3-(dimethylamino)-2-hydroxypropyl] 6-O-hexadecan-7-yl hexanedioate |
| PubChem CID | 175624907 |
| Molecular Formula | C27H53NO5 |
| Molecular Weight | 471.72 g/mol |
| Exact Mass | 471.39 |
| IUPAC Name | 1-O-[3-(dimethylamino)-2-hydroxypropyl] 6-O-hexadecan-7-yl hexanedioate |
| SMILES | CCCCCCCCCC(CCCCCC)OC(=O)CCCCC(=O)OCC(O)CN(C)C |
| InChI | InChI=1S/C27H53NO5/c1-5-7-9-11-12-13-15-19-25(18-14-10-8-6-2)33-27(31)21-17-16-20-26(30)32-23-24(29)22-28(3)4/h24-25,29H,5-23H2,1-4H3 |
| InChIKey | IYFRBFJRGKDAKJ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 471.72 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-O-[3-(dimethylamino)-2-hydroxypropyl] 6-O-hexadecan-7-yl hexanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-[3-(dimethylamino)-2-hydroxypropyl] 6-O-hexadecan-7-yl hexanedioate?
The IUPAC name of 1-O-[3-(dimethylamino)-2-hydroxypropyl] 6-O-hexadecan-7-yl hexanedioate (CID 175624907) is 1-O-[3-(dimethylamino)-2-hydroxypropyl] 6-O-hexadecan-7-yl hexanedioate.
What is the SMILES notation for 1-O-[3-(dimethylamino)-2-hydroxypropyl] 6-O-hexadecan-7-yl hexanedioate?
The canonical SMILES for 1-O-[3-(dimethylamino)-2-hydroxypropyl] 6-O-hexadecan-7-yl hexanedioate is CCCCCCCCCC(CCCCCC)OC(=O)CCCCC(=O)OCC(O)CN(C)C.
What is the InChIKey of 1-O-[3-(dimethylamino)-2-hydroxypropyl] 6-O-hexadecan-7-yl hexanedioate?
The InChIKey is IYFRBFJRGKDAKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H53NO5/c1-5-7-9-11-12-13-15-19-25(18-14-10-8-6-2)33-27(31)21-17-16-20-26(30)32-23-24(29)22-28(3)4/h24-25,29H,5-23H2,1-4H3.
What are the key properties of 1-O-[3-(dimethylamino)-2-hydroxypropyl] 6-O-hexadecan-7-yl hexanedioate?
1-O-[3-(dimethylamino)-2-hydroxypropyl] 6-O-hexadecan-7-yl hexanedioate has a molecular weight of 471.72 g/mol, XLogP of 6.04, 23 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-[3-(dimethylamino)-2-hydroxypropyl] 6-O-hexadecan-7-yl hexanedioate is sourced from PubChem (CID 175624907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).