About 6-O-[1-(dimethylamino)-3-(6-methoxyhexanoyloxy)propan-2-yl] 1-O-pentadecan-7-yl hexanedioate
6-O-[1-(dimethylamino)-3-(6-methoxyhexanoyloxy)propan-2-yl] 1-O-pentadecan-7-yl hexanedioate (PubChem CID 175624897) has the molecular formula C33H63NO7
and a molecular weight of 585.87 g/mol. Its IUPAC name is 6-O-[1-(dimethylamino)-3-(6-methoxyhexanoyloxy)propan-2-yl] 1-O-pentadecan-7-yl hexanedioate.
Molecular Properties
| Compound Name | 6-O-[1-(dimethylamino)-3-(6-methoxyhexanoyloxy)propan-2-yl] 1-O-pentadecan-7-yl hexanedioate |
| PubChem CID | 175624897 |
| Molecular Formula | C33H63NO7 |
| Molecular Weight | 585.87 g/mol |
| Exact Mass | 585.46 |
| IUPAC Name | 6-O-[1-(dimethylamino)-3-(6-methoxyhexanoyloxy)propan-2-yl] 1-O-pentadecan-7-yl hexanedioate |
| SMILES | CCCCCCCCC(CCCCCC)OC(=O)CCCCC(=O)OC(COC(=O)CCCCCOC)CN(C)C |
| InChI | InChI=1S/C33H63NO7/c1-6-8-10-12-13-16-22-29(21-15-11-9-7-2)40-32(36)24-18-19-25-33(37)41-30(27-34(3)4)28-39-31(35)23-17-14-20-26-38-5/h29-30H,6-28H2,1-5H3 |
| InChIKey | VNEXURUSFWULBI-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 585.87 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-O-[1-(dimethylamino)-3-(6-methoxyhexanoyloxy)propan-2-yl] 1-O-pentadecan-7-yl hexanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-O-[1-(dimethylamino)-3-(6-methoxyhexanoyloxy)propan-2-yl] 1-O-pentadecan-7-yl hexanedioate?
The IUPAC name of 6-O-[1-(dimethylamino)-3-(6-methoxyhexanoyloxy)propan-2-yl] 1-O-pentadecan-7-yl hexanedioate (CID 175624897) is 6-O-[1-(dimethylamino)-3-(6-methoxyhexanoyloxy)propan-2-yl] 1-O-pentadecan-7-yl hexanedioate.
What is the SMILES notation for 6-O-[1-(dimethylamino)-3-(6-methoxyhexanoyloxy)propan-2-yl] 1-O-pentadecan-7-yl hexanedioate?
The canonical SMILES for 6-O-[1-(dimethylamino)-3-(6-methoxyhexanoyloxy)propan-2-yl] 1-O-pentadecan-7-yl hexanedioate is CCCCCCCCC(CCCCCC)OC(=O)CCCCC(=O)OC(COC(=O)CCCCCOC)CN(C)C.
What is the InChIKey of 6-O-[1-(dimethylamino)-3-(6-methoxyhexanoyloxy)propan-2-yl] 1-O-pentadecan-7-yl hexanedioate?
The InChIKey is VNEXURUSFWULBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H63NO7/c1-6-8-10-12-13-16-22-29(21-15-11-9-7-2)40-32(36)24-18-19-25-33(37)41-30(27-34(3)4)28-39-31(35)23-17-14-20-26-38-5/h29-30H,6-28H2,1-5H3.
What are the key properties of 6-O-[1-(dimethylamino)-3-(6-methoxyhexanoyloxy)propan-2-yl] 1-O-pentadecan-7-yl hexanedioate?
6-O-[1-(dimethylamino)-3-(6-methoxyhexanoyloxy)propan-2-yl] 1-O-pentadecan-7-yl hexanedioate has a molecular weight of 585.87 g/mol, XLogP of 7.40, 29 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 6-O-[1-(dimethylamino)-3-(6-methoxyhexanoyloxy)propan-2-yl] 1-O-pentadecan-7-yl hexanedioate is sourced from PubChem (CID 175624897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).