About 1-O-hexyl 4-O-(1-methoxydecan-4-yl) butanedioate
1-O-hexyl 4-O-(1-methoxydecan-4-yl) butanedioate (PubChem CID 91702817) has the molecular formula C21H40O5
and a molecular weight of 372.55 g/mol. Its IUPAC name is 1-O-hexyl 4-O-(1-methoxydecan-4-yl) butanedioate.
Molecular Properties
| Compound Name | 1-O-hexyl 4-O-(1-methoxydecan-4-yl) butanedioate |
| PubChem CID | 91702817 |
| Molecular Formula | C21H40O5 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.29 |
| IUPAC Name | 1-O-hexyl 4-O-(1-methoxydecan-4-yl) butanedioate |
| SMILES | CCCCCCOC(=O)CCC(=O)OC(CCCCCC)CCCOC |
| InChI | InChI=1S/C21H40O5/c1-4-6-8-10-13-19(14-12-17-24-3)26-21(23)16-15-20(22)25-18-11-9-7-5-2/h19H,4-18H2,1-3H3 |
| InChIKey | DXMWDMIHGJGJCG-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-O-hexyl 4-O-(1-methoxydecan-4-yl) butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-hexyl 4-O-(1-methoxydecan-4-yl) butanedioate?
The IUPAC name of 1-O-hexyl 4-O-(1-methoxydecan-4-yl) butanedioate (CID 91702817) is 1-O-hexyl 4-O-(1-methoxydecan-4-yl) butanedioate.
What is the SMILES notation for 1-O-hexyl 4-O-(1-methoxydecan-4-yl) butanedioate?
The canonical SMILES for 1-O-hexyl 4-O-(1-methoxydecan-4-yl) butanedioate is CCCCCCOC(=O)CCC(=O)OC(CCCCCC)CCCOC.
What is the InChIKey of 1-O-hexyl 4-O-(1-methoxydecan-4-yl) butanedioate?
The InChIKey is DXMWDMIHGJGJCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H40O5/c1-4-6-8-10-13-19(14-12-17-24-3)26-21(23)16-15-20(22)25-18-11-9-7-5-2/h19H,4-18H2,1-3H3.
What are the key properties of 1-O-hexyl 4-O-(1-methoxydecan-4-yl) butanedioate?
1-O-hexyl 4-O-(1-methoxydecan-4-yl) butanedioate has a molecular weight of 372.55 g/mol, XLogP of 5.20, 18 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-hexyl 4-O-(1-methoxydecan-4-yl) butanedioate is sourced from PubChem (CID 91702817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).