C53H101NO9 — CID 175624418
1-O-[2-[8-(2-hexyldecanoyloxy)octanoyloxy]-3-[2-hydroxyethyl(methyl)amino]propyl] 8-O-pentadecan-7-yl octanedioate (PubChem CID 175624418) has the molecular formula C53H101NO9 and a molecular weight of 896.39 g/mol. Its IUPAC name is 1-O-[2-[8-(2-hexyldecanoyloxy)octanoyloxy]-3-[2-hydroxyethyl(methyl)amino]propyl] 8-O-pentadecan-7-yl octanedioate.
| Compound Name | 1-O-[2-[8-(2-hexyldecanoyloxy)octanoyloxy]-3-[2-hydroxyethyl(methyl)amino]propyl] 8-O-pentadecan-7-yl octanedioate |
|---|---|
| PubChem CID | 175624418 |
| Molecular Formula | C53H101NO9 |
| Molecular Weight | 896.39 g/mol |
| Exact Mass | 895.75 |
| IUPAC Name | 1-O-[2-[8-(2-hexyldecanoyloxy)octanoyloxy]-3-[2-hydroxyethyl(methyl)amino]propyl] 8-O-pentadecan-7-yl octanedioate |
| SMILES | CCCCCCCCC(CCCCCC)OC(=O)CCCCCCC(=O)OCC(CN(C)CCO)OC(=O)CCCCCCCOC(=O)C(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C53H101NO9/c1-6-10-14-18-21-28-36-47(35-27-16-12-8-3)53(59)60-44-34-26-20-23-32-41-52(58)63-49(45-54(5)42-43-55)46-61-50(56)39-31-24-25-33-40-51(57)62-48(37-29-17-13-9-4)38-30-22-19-15-11-7-2/h47-49,55H,6-46H2,1-5H3 |
| InChIKey | ZLIHKSVTPUNSSI-UHFFFAOYSA-N |
| XLogP | 13.56 |
| TPSA | 128.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 896.39 |
| LogP ≤ 5 | 13.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|