C46H89NO7 — CID 170791159
[2-(2-hexylundecanoyloxy)-3-[5-[2-hydroxyethyl(methyl)amino]pentanoyloxy]propyl] (2S)-2-hexyldodecanoate (PubChem CID 170791159) has the molecular formula C46H89NO7 and a molecular weight of 768.22 g/mol. Its IUPAC name is [2-(2-hexylundecanoyloxy)-3-[5-[2-hydroxyethyl(methyl)amino]pentanoyloxy]propyl] (2S)-2-hexyldodecanoate.
| Compound Name | [2-(2-hexylundecanoyloxy)-3-[5-[2-hydroxyethyl(methyl)amino]pentanoyloxy]propyl] (2S)-2-hexyldodecanoate |
|---|---|
| PubChem CID | 170791159 |
| Molecular Formula | C46H89NO7 |
| Molecular Weight | 768.22 g/mol |
| Exact Mass | 767.66 |
| IUPAC Name | [2-(2-hexylundecanoyloxy)-3-[5-[2-hydroxyethyl(methyl)amino]pentanoyloxy]propyl] (2S)-2-hexyldodecanoate |
| SMILES | CCCCCCCCCC[C@H](CCCCCC)C(=O)OCC(COC(=O)CCCCN(C)CCO)OC(=O)C(CCCCCC)CCCCCCCCC |
| InChI | InChI=1S/C46H89NO7/c1-6-10-14-18-20-22-24-27-32-41(31-25-16-12-8-3)45(50)53-40-43(39-52-44(49)35-29-30-36-47(5)37-38-48)54-46(51)42(33-26-17-13-9-4)34-28-23-21-19-15-11-7-2/h41-43,48H,6-40H2,1-5H3/t41-,42?,43?/m0/s1 |
| InChIKey | VBQLJASKCANLOK-BFGRSCGHSA-N |
| XLogP | 11.92 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.22 |
| LogP ≤ 5 | 11.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|