C51H97NO10 — CID 175624496
[6-[3-[bis(2-hydroxyethyl)amino]-2-[6-(2-hexyldecanoyloxy)hexanoyloxy]propoxy]-6-oxohexyl] 2-hexyldecanoate (PubChem CID 175624496) has the molecular formula C51H97NO10 and a molecular weight of 884.33 g/mol. Its IUPAC name is [6-[3-[bis(2-hydroxyethyl)amino]-2-[6-(2-hexyldecanoyloxy)hexanoyloxy]propoxy]-6-oxohexyl] 2-hexyldecanoate.
| Compound Name | [6-[3-[bis(2-hydroxyethyl)amino]-2-[6-(2-hexyldecanoyloxy)hexanoyloxy]propoxy]-6-oxohexyl] 2-hexyldecanoate |
|---|---|
| PubChem CID | 175624496 |
| Molecular Formula | C51H97NO10 |
| Molecular Weight | 884.33 g/mol |
| Exact Mass | 883.71 |
| IUPAC Name | [6-[3-[bis(2-hydroxyethyl)amino]-2-[6-(2-hexyldecanoyloxy)hexanoyloxy]propoxy]-6-oxohexyl] 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCCCCC(=O)OCC(CN(CCO)CCO)OC(=O)CCCCCOC(=O)C(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C51H97NO10/c1-5-9-13-17-19-25-33-45(31-23-15-11-7-3)50(57)59-41-29-21-27-35-48(55)61-44-47(43-52(37-39-53)38-40-54)62-49(56)36-28-22-30-42-60-51(58)46(32-24-16-12-8-4)34-26-20-18-14-10-6-2/h45-47,53-54H,5-44H2,1-4H3 |
| InChIKey | LQFDNCUQPKKGAS-UHFFFAOYSA-N |
| XLogP | 11.61 |
| TPSA | 148.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 884.33 |
| LogP ≤ 5 | 11.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|