C52H99NO9 — CID 175624363
[7-[2-[7-(2-hexyldecanoyloxy)heptanoyloxy]-3-[2-hydroxyethyl(methyl)amino]propoxy]-7-oxoheptyl] 2-hexyldecanoate (PubChem CID 175624363) has the molecular formula C52H99NO9 and a molecular weight of 882.36 g/mol. Its IUPAC name is [7-[2-[7-(2-hexyldecanoyloxy)heptanoyloxy]-3-[2-hydroxyethyl(methyl)amino]propoxy]-7-oxoheptyl] 2-hexyldecanoate.
| Compound Name | [7-[2-[7-(2-hexyldecanoyloxy)heptanoyloxy]-3-[2-hydroxyethyl(methyl)amino]propoxy]-7-oxoheptyl] 2-hexyldecanoate |
|---|---|
| PubChem CID | 175624363 |
| Molecular Formula | C52H99NO9 |
| Molecular Weight | 882.36 g/mol |
| Exact Mass | 881.73 |
| IUPAC Name | [7-[2-[7-(2-hexyldecanoyloxy)heptanoyloxy]-3-[2-hydroxyethyl(methyl)amino]propoxy]-7-oxoheptyl] 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCCCCCC(=O)OCC(CN(C)CCO)OC(=O)CCCCCCOC(=O)C(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C52H99NO9/c1-6-10-14-18-20-28-36-46(34-26-16-12-8-3)51(57)59-42-32-24-22-30-38-49(55)61-45-48(44-53(5)40-41-54)62-50(56)39-31-23-25-33-43-60-52(58)47(35-27-17-13-9-4)37-29-21-19-15-11-7-2/h46-48,54H,6-45H2,1-5H3 |
| InChIKey | UONOFTLDXQHSDI-UHFFFAOYSA-N |
| XLogP | 13.03 |
| TPSA | 128.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 882.36 |
| LogP ≤ 5 | 13.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|