C55H102N2O5 — CID 171658640
[2-[[[(Z)-dec-4-enoyl]-[3-(dimethylamino)propyl]amino]methyl]-3-[(Z)-octadec-9-enoyl]oxypropyl] (Z)-octadec-9-enoate (PubChem CID 171658640) has the molecular formula C55H102N2O5 and a molecular weight of 871.43 g/mol. Its IUPAC name is [2-[[[(Z)-dec-4-enoyl]-[3-(dimethylamino)propyl]amino]methyl]-3-[(Z)-octadec-9-enoyl]oxypropyl] (Z)-octadec-9-enoate.
| Compound Name | [2-[[[(Z)-dec-4-enoyl]-[3-(dimethylamino)propyl]amino]methyl]-3-[(Z)-octadec-9-enoyl]oxypropyl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 171658640 |
| Molecular Formula | C55H102N2O5 |
| Molecular Weight | 871.43 g/mol |
| Exact Mass | 870.78 |
| IUPAC Name | [2-[[[(Z)-dec-4-enoyl]-[3-(dimethylamino)propyl]amino]methyl]-3-[(Z)-octadec-9-enoyl]oxypropyl] (Z)-octadec-9-enoate |
| SMILES | CCCCC/C=C\CCC(=O)N(CCCN(C)C)CC(COC(=O)CCCCCCC/C=C\CCCCCCCC)COC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C55H102N2O5/c1-6-9-12-15-18-20-22-24-26-28-30-32-35-38-41-45-54(59)61-50-52(49-57(48-43-47-56(4)5)53(58)44-40-37-34-17-14-11-8-3)51-62-55(60)46-42-39-36-33-31-29-27-25-23-21-19-16-13-10-7-2/h24-27,34,37,52H,6-23,28-33,35-36,38-51H2,1-5H3/b26-24-,27-25-,37-34- |
| InChIKey | BFKDAWPAYZSGBQ-SZKCPTFLSA-N |
| XLogP | 15.46 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.43 |
| LogP ≤ 5 | 15.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|