C65H122N2O9 — CID 171658620
8-O-[2-[[[(Z)-dec-4-enoyl]-(3-pyrrolidin-1-ylpropyl)amino]methyl]-3-[8-(2-hexyloctoxy)-8-hydroxyoctanoyl]oxypropyl] 1-O-(2-hexyloctyl) octanedioate (PubChem CID 171658620) has the molecular formula C65H122N2O9 and a molecular weight of 1075.70 g/mol. Its IUPAC name is 8-O-[2-[[[(Z)-dec-4-enoyl]-(3-pyrrolidin-1-ylpropyl)amino]methyl]-3-[8-(2-hexyloctoxy)-8-hydroxyoctanoyl]oxypropyl] 1-O-(2-hexyloctyl) octanedioate.
| Compound Name | 8-O-[2-[[[(Z)-dec-4-enoyl]-(3-pyrrolidin-1-ylpropyl)amino]methyl]-3-[8-(2-hexyloctoxy)-8-hydroxyoctanoyl]oxypropyl] 1-O-(2-hexyloctyl) octanedioate |
|---|---|
| PubChem CID | 171658620 |
| Molecular Formula | C65H122N2O9 |
| Molecular Weight | 1075.70 g/mol |
| Exact Mass | 1074.92 |
| IUPAC Name | 8-O-[2-[[[(Z)-dec-4-enoyl]-(3-pyrrolidin-1-ylpropyl)amino]methyl]-3-[8-(2-hexyloctoxy)-8-hydroxyoctanoyl]oxypropyl] 1-O-(2-hexyloctyl) octanedioate |
| SMILES | CCCCC/C=C\CCC(=O)N(CCCN1CCCC1)CC(COC(=O)CCCCCCC(=O)OCC(CCCCCC)CCCCCC)COC(=O)CCCCCCC(O)OCC(CCCCCC)CCCCCC |
| InChI | InChI=1S/C65H122N2O9/c1-6-11-16-21-22-23-32-44-61(68)67(52-39-51-66-49-37-38-50-66)53-60(56-75-64(71)47-35-26-24-33-45-62(69)73-54-58(40-28-17-12-7-2)41-29-18-13-8-3)57-76-65(72)48-36-27-25-34-46-63(70)74-55-59(42-30-19-14-9-4)43-31-20-15-10-5/h22-23,58-60,62,69H,6-21,24-57H2,1-5H3/b23-22- |
| InChIKey | CGPIXEDMAAJHHR-FCQUAONHSA-N |
| XLogP | 16.59 |
| TPSA | 131.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 56 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1075.70 |
| LogP ≤ 5 | 16.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|