C56H95NO10 — CID 176711103
6-O-[2-[[6-[(Z)-2-[(Z)-hept-4-enyl]non-6-enoxy]-6-oxohexanoyl]oxymethyl]-3-(4-pyrrolidin-1-ylbutanoyloxy)propyl] 1-O-[(Z)-2-[(Z)-hept-4-enyl]non-6-enyl] hexanedioate (PubChem CID 176711103) has the molecular formula C56H95NO10 and a molecular weight of 942.37 g/mol. Its IUPAC name is 6-O-[2-[[6-[(Z)-2-[(Z)-hept-4-enyl]non-6-enoxy]-6-oxohexanoyl]oxymethyl]-3-(4-pyrrolidin-1-ylbutanoyloxy)propyl] 1-O-[(Z)-2-[(Z)-hept-4-enyl]non-6-enyl] hexanedioate.
| Compound Name | 6-O-[2-[[6-[(Z)-2-[(Z)-hept-4-enyl]non-6-enoxy]-6-oxohexanoyl]oxymethyl]-3-(4-pyrrolidin-1-ylbutanoyloxy)propyl] 1-O-[(Z)-2-[(Z)-hept-4-enyl]non-6-enyl] hexanedioate |
|---|---|
| PubChem CID | 176711103 |
| Molecular Formula | C56H95NO10 |
| Molecular Weight | 942.37 g/mol |
| Exact Mass | 941.70 |
| IUPAC Name | 6-O-[2-[[6-[(Z)-2-[(Z)-hept-4-enyl]non-6-enoxy]-6-oxohexanoyl]oxymethyl]-3-(4-pyrrolidin-1-ylbutanoyloxy)propyl] 1-O-[(Z)-2-[(Z)-hept-4-enyl]non-6-enyl] hexanedioate |
| SMILES | CC/C=C\CCCC(CCC/C=C\CC)COC(=O)CCCCC(=O)OCC(COC(=O)CCCCC(=O)OCC(CCC/C=C\CC)CCC/C=C\CC)COC(=O)CCCN1CCCC1 |
| InChI | InChI=1S/C56H95NO10/c1-5-9-13-17-21-32-49(33-22-18-14-10-6-2)44-63-52(58)36-25-27-38-54(60)65-46-51(48-67-56(62)40-31-43-57-41-29-30-42-57)47-66-55(61)39-28-26-37-53(59)64-45-50(34-23-19-15-11-7-3)35-24-20-16-12-8-4/h9-16,49-51H,5-8,17-48H2,1-4H3/b13-9-,14-10-,15-11-,16-12- |
| InChIKey | DLUYWKMVYJDRPV-NONDJZLBSA-N |
| XLogP | 13.09 |
| TPSA | 134.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 942.37 |
| LogP ≤ 5 | 13.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|