C50H91NO7 — CID 170917121
[2-[6-[3-(hydroxymethyl)azetidin-1-yl]hexanoyloxymethyl]-3-[(Z)-octadec-9-enoyl]oxypropyl] (Z)-octadec-9-enoate (PubChem CID 170917121) has the molecular formula C50H91NO7 and a molecular weight of 818.28 g/mol. Its IUPAC name is [2-[6-[3-(hydroxymethyl)azetidin-1-yl]hexanoyloxymethyl]-3-[(Z)-octadec-9-enoyl]oxypropyl] (Z)-octadec-9-enoate.
| Compound Name | [2-[6-[3-(hydroxymethyl)azetidin-1-yl]hexanoyloxymethyl]-3-[(Z)-octadec-9-enoyl]oxypropyl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 170917121 |
| Molecular Formula | C50H91NO7 |
| Molecular Weight | 818.28 g/mol |
| Exact Mass | 817.68 |
| IUPAC Name | [2-[6-[3-(hydroxymethyl)azetidin-1-yl]hexanoyloxymethyl]-3-[(Z)-octadec-9-enoyl]oxypropyl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(COC(=O)CCCCCCC/C=C\CCCCCCCC)COC(=O)CCCCCN1CC(CO)C1 |
| InChI | InChI=1S/C50H91NO7/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-32-36-48(53)56-43-47(45-58-50(55)38-34-31-35-39-51-40-46(41-51)42-52)44-57-49(54)37-33-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,46-47,52H,3-16,21-45H2,1-2H3/b19-17-,20-18- |
| InChIKey | BCNCGMYRCYANGL-CLFAGFIQSA-N |
| XLogP | 12.79 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.28 |
| LogP ≤ 5 | 12.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|