C46H87NO2 — CID 166035409
(5-methyl-2-propan-2-ylhexyl) (20Z,23Z)-10-(2-piperidin-1-ylethyl)nonacosa-20,23-dienoate (PubChem CID 166035409) has the molecular formula C46H87NO2 and a molecular weight of 686.21 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylhexyl) (20Z,23Z)-10-(2-piperidin-1-ylethyl)nonacosa-20,23-dienoate.
| Compound Name | (5-methyl-2-propan-2-ylhexyl) (20Z,23Z)-10-(2-piperidin-1-ylethyl)nonacosa-20,23-dienoate |
|---|---|
| PubChem CID | 166035409 |
| Molecular Formula | C46H87NO2 |
| Molecular Weight | 686.21 g/mol |
| Exact Mass | 685.67 |
| IUPAC Name | (5-methyl-2-propan-2-ylhexyl) (20Z,23Z)-10-(2-piperidin-1-ylethyl)nonacosa-20,23-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCCC(CCCCCCCCC(=O)OCC(CCC(C)C)C(C)C)CCN1CCCCC1 |
| InChI | InChI=1S/C46H87NO2/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23-27-32-44(37-40-47-38-30-26-31-39-47)33-28-24-21-22-25-29-34-46(48)49-41-45(43(4)5)36-35-42(2)3/h10-11,13-14,42-45H,6-9,12,15-41H2,1-5H3/b11-10-,14-13- |
| InChIKey | IGJOHLBCQLVRRJ-XVTLYKPTSA-N |
| XLogP | 14.44 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.21 |
| LogP ≤ 5 | 14.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|