C40H73NO2 — CID 170072525
2,3-dimethylbutyl (18Z,21Z,23E)-10-(2-piperidin-1-ylethyl)heptacosa-18,21,23-trienoate (PubChem CID 170072525) has the molecular formula C40H73NO2 and a molecular weight of 600.03 g/mol. Its IUPAC name is 2,3-dimethylbutyl (18Z,21Z,23E)-10-(2-piperidin-1-ylethyl)heptacosa-18,21,23-trienoate.
| Compound Name | 2,3-dimethylbutyl (18Z,21Z,23E)-10-(2-piperidin-1-ylethyl)heptacosa-18,21,23-trienoate |
|---|---|
| PubChem CID | 170072525 |
| Molecular Formula | C40H73NO2 |
| Molecular Weight | 600.03 g/mol |
| Exact Mass | 599.56 |
| IUPAC Name | 2,3-dimethylbutyl (18Z,21Z,23E)-10-(2-piperidin-1-ylethyl)heptacosa-18,21,23-trienoate |
| SMILES | CCC/C=C/C=C\C/C=C\CCCCCCCC(CCCCCCCCC(=O)OCC(C)C(C)C)CCN1CCCCC1 |
| InChI | InChI=1S/C40H73NO2/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-20-24-29-39(32-35-41-33-27-23-28-34-41)30-25-21-18-19-22-26-31-40(42)43-36-38(4)37(2)3/h7-10,12-13,37-39H,5-6,11,14-36H2,1-4H3/b8-7+,10-9-,13-12- |
| InChIKey | XLKVXSGCURHQKU-QGZCUJNXSA-N |
| XLogP | 12.02 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.03 |
| LogP ≤ 5 | 12.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|