C44H81NO4 — CID 152587343
(Z)-2-[1-[(Z)-octadec-9-enoyl]oxy-4-pyrrolidin-1-ylbutan-2-yl]octadec-9-enoic acid (PubChem CID 152587343) has the molecular formula C44H81NO4 and a molecular weight of 688.13 g/mol. Its IUPAC name is (Z)-2-[1-[(Z)-octadec-9-enoyl]oxy-4-pyrrolidin-1-ylbutan-2-yl]octadec-9-enoic acid.
| Compound Name | (Z)-2-[1-[(Z)-octadec-9-enoyl]oxy-4-pyrrolidin-1-ylbutan-2-yl]octadec-9-enoic acid |
|---|---|
| PubChem CID | 152587343 |
| Molecular Formula | C44H81NO4 |
| Molecular Weight | 688.13 g/mol |
| Exact Mass | 687.62 |
| IUPAC Name | (Z)-2-[1-[(Z)-octadec-9-enoyl]oxy-4-pyrrolidin-1-ylbutan-2-yl]octadec-9-enoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(CCN1CCCC1)C(CCCCCC/C=C\CCCCCCCC)C(=O)O |
| InChI | InChI=1S/C44H81NO4/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-35-43(46)49-40-41(36-39-45-37-32-33-38-45)42(44(47)48)34-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,41-42H,3-16,21-40H2,1-2H3,(H,47,48)/b19-17-,20-18- |
| InChIKey | YUSUFMMFWOUQMU-CLFAGFIQSA-N |
| XLogP | 13.02 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.13 |
| LogP ≤ 5 | 13.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|