ethyl 4-piperidin-1-ylbutanoate

C11H21NO2 — CID 14044356

IUPACethyl 4-piperidin-1-ylbutanoate
SMILESCCOC(=O)CCCN1CCCCC1
InChIInChI=1S/C11H21NO2/c1-2-14-11(13)7-6-10-12-8-4-3-5-9-12/h2-10H2,1H3
InChIKeyAPFAWTXPJCYORE-UHFFFAOYSA-N
MW199.29 g/mol
LogP1.82
Rot. Bonds5

About ethyl 4-piperidin-1-ylbutanoate

ethyl 4-piperidin-1-ylbutanoate (PubChem CID 14044356) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is ethyl 4-piperidin-1-ylbutanoate.

Molecular Properties

Compound Nameethyl 4-piperidin-1-ylbutanoate
PubChem CID14044356
Molecular FormulaC11H21NO2
Molecular Weight199.29 g/mol
Exact Mass199.16
IUPAC Nameethyl 4-piperidin-1-ylbutanoate
SMILESCCOC(=O)CCCN1CCCCC1
InChIInChI=1S/C11H21NO2/c1-2-14-11(13)7-6-10-12-8-4-3-5-9-12/h2-10H2,1H3
InChIKeyAPFAWTXPJCYORE-UHFFFAOYSA-N
XLogP1.82
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.29
LogP ≤ 51.82
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze ethyl 4-piperidin-1-ylbutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 4-piperidin-1-ylbutanoate?
The IUPAC name of ethyl 4-piperidin-1-ylbutanoate (CID 14044356) is ethyl 4-piperidin-1-ylbutanoate.
What is the SMILES notation for ethyl 4-piperidin-1-ylbutanoate?
The canonical SMILES for ethyl 4-piperidin-1-ylbutanoate is CCOC(=O)CCCN1CCCCC1.
What is the InChIKey of ethyl 4-piperidin-1-ylbutanoate?
The InChIKey is APFAWTXPJCYORE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO2/c1-2-14-11(13)7-6-10-12-8-4-3-5-9-12/h2-10H2,1H3.
What are the key properties of ethyl 4-piperidin-1-ylbutanoate?
ethyl 4-piperidin-1-ylbutanoate has a molecular weight of 199.29 g/mol, XLogP of 1.82, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-piperidin-1-ylbutanoate is sourced from PubChem (CID 14044356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).