C48H92N2O4 — CID 171640456
2-butyloctyl 11-[nonanoyl(3-pyrrolidin-1-ylpropyl)amino]-20-oxoicosanoate (PubChem CID 171640456) has the molecular formula C48H92N2O4 and a molecular weight of 761.27 g/mol. Its IUPAC name is 2-butyloctyl 11-[nonanoyl(3-pyrrolidin-1-ylpropyl)amino]-20-oxoicosanoate.
| Compound Name | 2-butyloctyl 11-[nonanoyl(3-pyrrolidin-1-ylpropyl)amino]-20-oxoicosanoate |
|---|---|
| PubChem CID | 171640456 |
| Molecular Formula | C48H92N2O4 |
| Molecular Weight | 761.27 g/mol |
| Exact Mass | 760.71 |
| IUPAC Name | 2-butyloctyl 11-[nonanoyl(3-pyrrolidin-1-ylpropyl)amino]-20-oxoicosanoate |
| SMILES | CCCCCCCCC(=O)N(CCCN1CCCC1)C(CCCCCCCCC=O)CCCCCCCCCC(=O)OCC(CCCC)CCCCCC |
| InChI | InChI=1S/C48H92N2O4/c1-4-7-10-12-21-27-37-47(52)50(42-32-41-49-39-29-30-40-49)46(36-26-20-16-14-18-23-31-43-51)35-25-19-15-13-17-22-28-38-48(53)54-44-45(33-9-6-3)34-24-11-8-5-2/h43,45-46H,4-42,44H2,1-3H3 |
| InChIKey | KALPPWZGMZLTDR-UHFFFAOYSA-N |
| XLogP | 13.57 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.27 |
| LogP ≤ 5 | 13.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|