C60H118N2O5 — CID 174350889
bis(2-hexyldecyl) 7-[decyl-[4-(methylamino)butanoyl]amino]tridecanedioate (PubChem CID 174350889) has the molecular formula C60H118N2O5 and a molecular weight of 947.61 g/mol. Its IUPAC name is bis(2-hexyldecyl) 7-[decyl-[4-(methylamino)butanoyl]amino]tridecanedioate.
| Compound Name | bis(2-hexyldecyl) 7-[decyl-[4-(methylamino)butanoyl]amino]tridecanedioate |
|---|---|
| PubChem CID | 174350889 |
| Molecular Formula | C60H118N2O5 |
| Molecular Weight | 947.61 g/mol |
| Exact Mass | 946.90 |
| IUPAC Name | bis(2-hexyldecyl) 7-[decyl-[4-(methylamino)butanoyl]amino]tridecanedioate |
| SMILES | CCCCCCCCCCN(C(=O)CCCNC)C(CCCCCC(=O)OCC(CCCCCC)CCCCCCCC)CCCCCC(=O)OCC(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C60H118N2O5/c1-7-12-17-22-25-26-29-40-52-62(58(63)48-41-51-61-6)57(46-36-30-38-49-59(64)66-53-55(42-32-20-15-10-4)44-34-27-23-18-13-8-2)47-37-31-39-50-60(65)67-54-56(43-33-21-16-11-5)45-35-28-24-19-14-9-3/h55-57,61H,7-54H2,1-6H3 |
| InChIKey | FCBSDXKSRGNGRI-UHFFFAOYSA-N |
| XLogP | 17.99 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 54 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 947.61 |
| LogP ≤ 5 | 17.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|