C54H104N2O7 — CID 171541859
1-O-(2-ethylbutyl) 19-O-(2-ethylhexyl) 10-[9-(2-ethylhexanoyloxy)nonanoyl-[3-(methylamino)propyl]amino]nonadecanedioate (PubChem CID 171541859) has the molecular formula C54H104N2O7 and a molecular weight of 893.43 g/mol. Its IUPAC name is 1-O-(2-ethylbutyl) 19-O-(2-ethylhexyl) 10-[9-(2-ethylhexanoyloxy)nonanoyl-[3-(methylamino)propyl]amino]nonadecanedioate.
| Compound Name | 1-O-(2-ethylbutyl) 19-O-(2-ethylhexyl) 10-[9-(2-ethylhexanoyloxy)nonanoyl-[3-(methylamino)propyl]amino]nonadecanedioate |
|---|---|
| PubChem CID | 171541859 |
| Molecular Formula | C54H104N2O7 |
| Molecular Weight | 893.43 g/mol |
| Exact Mass | 892.78 |
| IUPAC Name | 1-O-(2-ethylbutyl) 19-O-(2-ethylhexyl) 10-[9-(2-ethylhexanoyloxy)nonanoyl-[3-(methylamino)propyl]amino]nonadecanedioate |
| SMILES | CCCCC(CC)COC(=O)CCCCCCCCC(CCCCCCCCC(=O)OCC(CC)CC)N(CCCNC)C(=O)CCCCCCCCOC(=O)C(CC)CCCC |
| InChI | InChI=1S/C54H104N2O7/c1-8-14-35-48(12-5)46-63-53(59)41-32-26-19-17-23-29-38-50(37-28-22-16-18-25-31-40-52(58)62-45-47(10-3)11-4)56(43-34-42-55-7)51(57)39-30-24-20-21-27-33-44-61-54(60)49(13-6)36-15-9-2/h47-50,55H,8-46H2,1-7H3 |
| InChIKey | UZYGJHSVRKJDJH-UHFFFAOYSA-N |
| XLogP | 14.26 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 893.43 |
| LogP ≤ 5 | 14.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|