C58H114N2O5 — CID 146431089
bis(2-butyloctyl) 10-[3-(dimethylamino)propyl-(2-ethylheptanoyl)amino]icosanedioate (PubChem CID 146431089) has the molecular formula C58H114N2O5 and a molecular weight of 919.56 g/mol. Its IUPAC name is bis(2-butyloctyl) 10-[3-(dimethylamino)propyl-(2-ethylheptanoyl)amino]icosanedioate.
| Compound Name | bis(2-butyloctyl) 10-[3-(dimethylamino)propyl-(2-ethylheptanoyl)amino]icosanedioate |
|---|---|
| PubChem CID | 146431089 |
| Molecular Formula | C58H114N2O5 |
| Molecular Weight | 919.56 g/mol |
| Exact Mass | 918.87 |
| IUPAC Name | bis(2-butyloctyl) 10-[3-(dimethylamino)propyl-(2-ethylheptanoyl)amino]icosanedioate |
| SMILES | CCCCCCC(CCCC)COC(=O)CCCCCCCCCC(CCCCCCCCC(=O)OCC(CCCC)CCCCCC)N(CCCN(C)C)C(=O)C(CC)CCCCC |
| InChI | InChI=1S/C58H114N2O5/c1-9-15-20-32-41-52(39-18-12-4)50-64-56(61)46-36-29-24-22-23-27-34-44-55(60(49-38-48-59(7)8)58(63)54(14-6)43-31-17-11-3)45-35-28-25-26-30-37-47-57(62)65-51-53(40-19-13-5)42-33-21-16-10-2/h52-55H,9-51H2,1-8H3 |
| InChIKey | NWAFIPFQUHUPDQ-UHFFFAOYSA-N |
| XLogP | 17.01 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 919.56 |
| LogP ≤ 5 | 17.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|