C58H99F15N2O5 — CID 177078520
1-O-(2-hexyldecyl) 13-O-(2-hexyloctyl) 7-[5-(dimethylamino)pentyl-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyl)amino]tridecanedioate (PubChem CID 177078520) has the molecular formula C58H99F15N2O5 and a molecular weight of 1189.41 g/mol. Its IUPAC name is 1-O-(2-hexyldecyl) 13-O-(2-hexyloctyl) 7-[5-(dimethylamino)pentyl-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyl)amino]tridecanedioate.
| Compound Name | 1-O-(2-hexyldecyl) 13-O-(2-hexyloctyl) 7-[5-(dimethylamino)pentyl-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyl)amino]tridecanedioate |
|---|---|
| PubChem CID | 177078520 |
| Molecular Formula | C58H99F15N2O5 |
| Molecular Weight | 1189.41 g/mol |
| Exact Mass | 1188.73 |
| IUPAC Name | 1-O-(2-hexyldecyl) 13-O-(2-hexyloctyl) 7-[5-(dimethylamino)pentyl-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyl)amino]tridecanedioate |
| SMILES | CCCCCCCCC(CCCCCC)COC(=O)CCCCCC(CCCCCC(=O)OCC(CCCCCC)CCCCCC)N(CCCCCN(C)C)C(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C58H99F15N2O5/c1-7-11-15-19-20-27-37-47(36-26-18-14-10-4)45-80-50(77)41-31-22-29-39-48(38-28-21-30-40-49(76)79-44-46(34-24-16-12-8-2)35-25-17-13-9-3)75(43-33-23-32-42-74(5)6)51(78)52(59,60)53(61,62)54(63,64)55(65,66)56(67,68)57(69,70)58(71,72)73/h46-48H,7-45H2,1-6H3 |
| InChIKey | IJYWGXSDYUKXEE-UHFFFAOYSA-N |
| XLogP | 19.17 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 51 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1189.41 |
| LogP ≤ 5 | 19.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|