C58H114N2O7 — CID 171658874
2-butyloctyl 8-[3-[8-(2-butyloctoxy)-8-oxooctoxy]-2-[4-(dimethylamino)butyl-nonanoylamino]propoxy]octanoate (PubChem CID 171658874) has the molecular formula C58H114N2O7 and a molecular weight of 951.56 g/mol. Its IUPAC name is 2-butyloctyl 8-[3-[8-(2-butyloctoxy)-8-oxooctoxy]-2-[4-(dimethylamino)butyl-nonanoylamino]propoxy]octanoate.
| Compound Name | 2-butyloctyl 8-[3-[8-(2-butyloctoxy)-8-oxooctoxy]-2-[4-(dimethylamino)butyl-nonanoylamino]propoxy]octanoate |
|---|---|
| PubChem CID | 171658874 |
| Molecular Formula | C58H114N2O7 |
| Molecular Weight | 951.56 g/mol |
| Exact Mass | 950.86 |
| IUPAC Name | 2-butyloctyl 8-[3-[8-(2-butyloctoxy)-8-oxooctoxy]-2-[4-(dimethylamino)butyl-nonanoylamino]propoxy]octanoate |
| SMILES | CCCCCCCCC(=O)N(CCCCN(C)C)C(COCCCCCCCC(=O)OCC(CCCC)CCCCCC)COCCCCCCCC(=O)OCC(CCCC)CCCCCC |
| InChI | InChI=1S/C58H114N2O7/c1-8-13-18-21-24-31-42-56(61)60(46-35-34-45-59(6)7)55(51-64-47-36-27-22-25-32-43-57(62)66-49-53(38-16-11-4)40-29-19-14-9-2)52-65-48-37-28-23-26-33-44-58(63)67-50-54(39-17-12-5)41-30-20-15-10-3/h53-55H,8-52H2,1-7H3 |
| InChIKey | ZEBNITWFASHABI-UHFFFAOYSA-N |
| XLogP | 15.63 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 53 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 951.56 |
| LogP ≤ 5 | 15.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|