C44H88N2O3 — CID 146431090
2-butyloctyl 10-[3-(dimethylamino)propyl-(2-ethylheptanoyl)amino]octadecanoate (PubChem CID 146431090) has the molecular formula C44H88N2O3 and a molecular weight of 693.20 g/mol. Its IUPAC name is 2-butyloctyl 10-[3-(dimethylamino)propyl-(2-ethylheptanoyl)amino]octadecanoate.
| Compound Name | 2-butyloctyl 10-[3-(dimethylamino)propyl-(2-ethylheptanoyl)amino]octadecanoate |
|---|---|
| PubChem CID | 146431090 |
| Molecular Formula | C44H88N2O3 |
| Molecular Weight | 693.20 g/mol |
| Exact Mass | 692.68 |
| IUPAC Name | 2-butyloctyl 10-[3-(dimethylamino)propyl-(2-ethylheptanoyl)amino]octadecanoate |
| SMILES | CCCCCCCCC(CCCCCCCCC(=O)OCC(CCCC)CCCCCC)N(CCCN(C)C)C(=O)C(CC)CCCCC |
| InChI | InChI=1S/C44H88N2O3/c1-8-13-17-19-22-27-34-42(46(38-30-37-45(6)7)44(48)41(12-5)33-25-15-10-3)35-28-23-20-21-24-29-36-43(47)49-39-40(31-16-11-4)32-26-18-14-9-2/h40-42H,8-39H2,1-7H3 |
| InChIKey | IARKCZSSRNEVEE-UHFFFAOYSA-N |
| XLogP | 12.93 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.20 |
| LogP ≤ 5 | 12.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|