C57H112N2O5S2 — CID 171658857
bis(2-butyloctyl) 10-[4-(dimethylamino)butyl-[3-(pentyldisulfanyl)propanoyl]amino]nonadecanedioate (PubChem CID 171658857) has the molecular formula C57H112N2O5S2 and a molecular weight of 969.67 g/mol. Its IUPAC name is bis(2-butyloctyl) 10-[4-(dimethylamino)butyl-[3-(pentyldisulfanyl)propanoyl]amino]nonadecanedioate.
| Compound Name | bis(2-butyloctyl) 10-[4-(dimethylamino)butyl-[3-(pentyldisulfanyl)propanoyl]amino]nonadecanedioate |
|---|---|
| PubChem CID | 171658857 |
| Molecular Formula | C57H112N2O5S2 |
| Molecular Weight | 969.67 g/mol |
| Exact Mass | 968.80 |
| IUPAC Name | bis(2-butyloctyl) 10-[4-(dimethylamino)butyl-[3-(pentyldisulfanyl)propanoyl]amino]nonadecanedioate |
| SMILES | CCCCCCC(CCCC)COC(=O)CCCCCCCCC(CCCCCCCCC(=O)OCC(CCCC)CCCCCC)N(CCCCN(C)C)C(=O)CCSSCCCCC |
| InChI | InChI=1S/C57H112N2O5S2/c1-8-13-18-28-39-52(37-16-11-4)50-63-56(61)43-32-26-22-20-24-30-41-54(59(47-35-34-46-58(6)7)55(60)45-49-66-65-48-36-15-10-3)42-31-25-21-23-27-33-44-57(62)64-51-53(38-17-12-5)40-29-19-14-9-2/h52-54H,8-51H2,1-7H3 |
| InChIKey | AAKKRQAHDKXDHM-UHFFFAOYSA-N |
| XLogP | 17.37 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 52 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 969.67 |
| LogP ≤ 5 | 17.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|