C61H120N2O6S2 — CID 171658979
bis(2-butyloctyl) 10-[3-(dimethylamino)propyl-[3-[2-(octyldisulfanyl)ethoxy]-3-oxopropyl]amino]nonadecanedioate (PubChem CID 171658979) has the molecular formula C61H120N2O6S2 and a molecular weight of 1041.77 g/mol. Its IUPAC name is bis(2-butyloctyl) 10-[3-(dimethylamino)propyl-[3-[2-(octyldisulfanyl)ethoxy]-3-oxopropyl]amino]nonadecanedioate.
| Compound Name | bis(2-butyloctyl) 10-[3-(dimethylamino)propyl-[3-[2-(octyldisulfanyl)ethoxy]-3-oxopropyl]amino]nonadecanedioate |
|---|---|
| PubChem CID | 171658979 |
| Molecular Formula | C61H120N2O6S2 |
| Molecular Weight | 1041.77 g/mol |
| Exact Mass | 1040.86 |
| IUPAC Name | bis(2-butyloctyl) 10-[3-(dimethylamino)propyl-[3-[2-(octyldisulfanyl)ethoxy]-3-oxopropyl]amino]nonadecanedioate |
| SMILES | CCCCCCCCSSCCOC(=O)CCN(CCCN(C)C)C(CCCCCCCCC(=O)OCC(CCCC)CCCCCC)CCCCCCCCC(=O)OCC(CCCC)CCCCCC |
| InChI | InChI=1S/C61H120N2O6S2/c1-8-13-18-21-30-37-52-70-71-53-51-67-61(66)47-50-63(49-38-48-62(6)7)58(43-33-26-22-24-28-35-45-59(64)68-54-56(39-16-11-4)41-31-19-14-9-2)44-34-27-23-25-29-36-46-60(65)69-55-57(40-17-12-5)42-32-20-15-10-3/h56-58H,8-55H2,1-7H3 |
| InChIKey | SKALNRBESUUGIQ-UHFFFAOYSA-N |
| XLogP | 18.17 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 57 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1041.77 |
| LogP ≤ 5 | 18.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|