C48H96N2O4S — CID 171073879
2-hexyldecyl 6-[3-(dimethylamino)propyl-[3-[2-(2-hexyldecylsulfanyl)ethoxy]-3-oxopropyl]amino]hexanoate (PubChem CID 171073879) has the molecular formula C48H96N2O4S and a molecular weight of 797.37 g/mol. Its IUPAC name is 2-hexyldecyl 6-[3-(dimethylamino)propyl-[3-[2-(2-hexyldecylsulfanyl)ethoxy]-3-oxopropyl]amino]hexanoate.
| Compound Name | 2-hexyldecyl 6-[3-(dimethylamino)propyl-[3-[2-(2-hexyldecylsulfanyl)ethoxy]-3-oxopropyl]amino]hexanoate |
|---|---|
| PubChem CID | 171073879 |
| Molecular Formula | C48H96N2O4S |
| Molecular Weight | 797.37 g/mol |
| Exact Mass | 796.71 |
| IUPAC Name | 2-hexyldecyl 6-[3-(dimethylamino)propyl-[3-[2-(2-hexyldecylsulfanyl)ethoxy]-3-oxopropyl]amino]hexanoate |
| SMILES | CCCCCCCCC(CCCCCC)COC(=O)CCCCCN(CCCN(C)C)CCC(=O)OCCSCC(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C48H96N2O4S/c1-7-11-15-19-21-26-32-45(31-24-17-13-9-3)43-54-47(51)35-28-23-29-38-50(39-30-37-49(5)6)40-36-48(52)53-41-42-55-44-46(33-25-18-14-10-4)34-27-22-20-16-12-8-2/h45-46H,7-44H2,1-6H3 |
| InChIKey | DVIVNAKIOGHRSQ-UHFFFAOYSA-N |
| XLogP | 13.68 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.37 |
| LogP ≤ 5 | 13.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|