C47H94N2O4S6 — CID 174330831
2-(2-hexyldecyltrisulfanyl)ethyl 3-[3-(dimethylamino)propyl-[3-[2-(2-hexyldecyltrisulfanyl)ethoxy]-3-oxopropyl]amino]propanoate (PubChem CID 174330831) has the molecular formula C47H94N2O4S6 and a molecular weight of 943.68 g/mol. Its IUPAC name is 2-(2-hexyldecyltrisulfanyl)ethyl 3-[3-(dimethylamino)propyl-[3-[2-(2-hexyldecyltrisulfanyl)ethoxy]-3-oxopropyl]amino]propanoate.
| Compound Name | 2-(2-hexyldecyltrisulfanyl)ethyl 3-[3-(dimethylamino)propyl-[3-[2-(2-hexyldecyltrisulfanyl)ethoxy]-3-oxopropyl]amino]propanoate |
|---|---|
| PubChem CID | 174330831 |
| Molecular Formula | C47H94N2O4S6 |
| Molecular Weight | 943.68 g/mol |
| Exact Mass | 942.55 |
| IUPAC Name | 2-(2-hexyldecyltrisulfanyl)ethyl 3-[3-(dimethylamino)propyl-[3-[2-(2-hexyldecyltrisulfanyl)ethoxy]-3-oxopropyl]amino]propanoate |
| SMILES | CCCCCCCCC(CCCCCC)CSSSCCOC(=O)CCN(CCCN(C)C)CCC(=O)OCCSSSCC(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C47H94N2O4S6/c1-7-11-15-19-21-25-30-44(28-23-17-13-9-3)42-56-58-54-40-38-52-46(50)32-36-49(35-27-34-48(5)6)37-33-47(51)53-39-41-55-59-57-43-45(29-24-18-14-10-4)31-26-22-20-16-12-8-2/h44-45H,7-43H2,1-6H3 |
| InChIKey | GWWIMKVSTIVFDB-UHFFFAOYSA-N |
| XLogP | 15.84 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.68 |
| LogP ≤ 5 | 15.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|