C35H70N2O4S6 — CID 171808862
2-(decyltrisulfanyl)ethyl 3-[3-[[3-[2-(decyltrisulfanyl)ethoxy]-3-oxopropyl]-methylamino]propyl-methylamino]propanoate (PubChem CID 171808862) has the molecular formula C35H70N2O4S6 and a molecular weight of 775.36 g/mol. Its IUPAC name is 2-(decyltrisulfanyl)ethyl 3-[3-[[3-[2-(decyltrisulfanyl)ethoxy]-3-oxopropyl]-methylamino]propyl-methylamino]propanoate.
| Compound Name | 2-(decyltrisulfanyl)ethyl 3-[3-[[3-[2-(decyltrisulfanyl)ethoxy]-3-oxopropyl]-methylamino]propyl-methylamino]propanoate |
|---|---|
| PubChem CID | 171808862 |
| Molecular Formula | C35H70N2O4S6 |
| Molecular Weight | 775.36 g/mol |
| Exact Mass | 774.37 |
| IUPAC Name | 2-(decyltrisulfanyl)ethyl 3-[3-[[3-[2-(decyltrisulfanyl)ethoxy]-3-oxopropyl]-methylamino]propyl-methylamino]propanoate |
| SMILES | CCCCCCCCCCSSSCCOC(=O)CCN(C)CCCN(C)CCC(=O)OCCSSSCCCCCCCCCC |
| InChI | InChI=1S/C35H70N2O4S6/c1-5-7-9-11-13-15-17-19-30-42-46-44-32-28-40-34(38)22-26-36(3)24-21-25-37(4)27-23-35(39)41-29-33-45-47-43-31-20-18-16-14-12-10-8-6-2/h5-33H2,1-4H3 |
| InChIKey | SFICPQDITWJWDD-UHFFFAOYSA-N |
| XLogP | 11.45 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.36 |
| LogP ≤ 5 | 11.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|