C44H86N2O7S6 — CID 169182869
2-(octyldisulfanyl)ethyl 3-[3-[2-hydroxyethyl-[3-[2-(octyldisulfanyl)ethoxy]-3-oxopropyl]amino]propyl-[3-[2-(octyldisulfanyl)ethoxy]-3-oxopropyl]amino]propanoate (PubChem CID 169182869) has the molecular formula C44H86N2O7S6 and a molecular weight of 947.58 g/mol. Its IUPAC name is 2-(octyldisulfanyl)ethyl 3-[3-[2-hydroxyethyl-[3-[2-(octyldisulfanyl)ethoxy]-3-oxopropyl]amino]propyl-[3-[2-(octyldisulfanyl)ethoxy]-3-oxopropyl]amino]propanoate.
| Compound Name | 2-(octyldisulfanyl)ethyl 3-[3-[2-hydroxyethyl-[3-[2-(octyldisulfanyl)ethoxy]-3-oxopropyl]amino]propyl-[3-[2-(octyldisulfanyl)ethoxy]-3-oxopropyl]amino]propanoate |
|---|---|
| PubChem CID | 169182869 |
| Molecular Formula | C44H86N2O7S6 |
| Molecular Weight | 947.58 g/mol |
| Exact Mass | 946.48 |
| IUPAC Name | 2-(octyldisulfanyl)ethyl 3-[3-[2-hydroxyethyl-[3-[2-(octyldisulfanyl)ethoxy]-3-oxopropyl]amino]propyl-[3-[2-(octyldisulfanyl)ethoxy]-3-oxopropyl]amino]propanoate |
| SMILES | CCCCCCCCSSCCOC(=O)CCN(CCO)CCCN(CCC(=O)OCCSSCCCCCCCC)CCC(=O)OCCSSCCCCCCCC |
| InChI | InChI=1S/C44H86N2O7S6/c1-4-7-10-13-16-19-36-54-57-39-33-51-42(48)23-28-45(29-24-43(49)52-34-40-58-55-37-20-17-14-11-8-5-2)26-22-27-46(31-32-47)30-25-44(50)53-35-41-59-56-38-21-18-15-12-9-6-3/h47H,4-41H2,1-3H3 |
| InChIKey | QSXXMNLMXYASGA-UHFFFAOYSA-N |
| XLogP | 12.00 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 947.58 |
| LogP ≤ 5 | 12.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|