C55H106N2O9S8 — CID 169182870
2-(octyldisulfanyl)ethyl 3-[[3-[bis[3-[2-(octyldisulfanyl)ethoxy]-3-oxopropyl]amino]-2-hydroxypropyl]-[3-[2-(octyldisulfanyl)ethoxy]-3-oxopropyl]amino]propanoate (PubChem CID 169182870) has the molecular formula C55H106N2O9S8 and a molecular weight of 1195.99 g/mol. Its IUPAC name is 2-(octyldisulfanyl)ethyl 3-[[3-[bis[3-[2-(octyldisulfanyl)ethoxy]-3-oxopropyl]amino]-2-hydroxypropyl]-[3-[2-(octyldisulfanyl)ethoxy]-3-oxopropyl]amino]propanoate.
| Compound Name | 2-(octyldisulfanyl)ethyl 3-[[3-[bis[3-[2-(octyldisulfanyl)ethoxy]-3-oxopropyl]amino]-2-hydroxypropyl]-[3-[2-(octyldisulfanyl)ethoxy]-3-oxopropyl]amino]propanoate |
|---|---|
| PubChem CID | 169182870 |
| Molecular Formula | C55H106N2O9S8 |
| Molecular Weight | 1195.99 g/mol |
| Exact Mass | 1194.57 |
| IUPAC Name | 2-(octyldisulfanyl)ethyl 3-[[3-[bis[3-[2-(octyldisulfanyl)ethoxy]-3-oxopropyl]amino]-2-hydroxypropyl]-[3-[2-(octyldisulfanyl)ethoxy]-3-oxopropyl]amino]propanoate |
| SMILES | CCCCCCCCSSCCOC(=O)CCN(CCC(=O)OCCSSCCCCCCCC)CC(O)CN(CCC(=O)OCCSSCCCCCCCC)CCC(=O)OCCSSCCCCCCCC |
| InChI | InChI=1S/C55H106N2O9S8/c1-5-9-13-17-21-25-41-67-71-45-37-63-52(59)29-33-56(34-30-53(60)64-38-46-72-68-42-26-22-18-14-10-6-2)49-51(58)50-57(35-31-54(61)65-39-47-73-69-43-27-23-19-15-11-7-3)36-32-55(62)66-40-48-74-70-44-28-24-20-16-12-8-4/h51,58H,5-50H2,1-4H3 |
| InChIKey | FSNDXYZKKHSEAC-UHFFFAOYSA-N |
| XLogP | 15.65 |
| TPSA | 131.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 60 |
| Heavy Atoms | 74 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1195.99 |
| LogP ≤ 5 | 15.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|