C17H34O2S2 — CID 164784476
2-(octyldisulfanyl)ethyl 4,4-dimethylpentanoate (PubChem CID 164784476) has the molecular formula C17H34O2S2 and a molecular weight of 334.59 g/mol. Its IUPAC name is 2-(octyldisulfanyl)ethyl 4,4-dimethylpentanoate.
| Compound Name | 2-(octyldisulfanyl)ethyl 4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 164784476 |
| Molecular Formula | C17H34O2S2 |
| Molecular Weight | 334.59 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 2-(octyldisulfanyl)ethyl 4,4-dimethylpentanoate |
| SMILES | CCCCCCCCSSCCOC(=O)CCC(C)(C)C |
| InChI | InChI=1S/C17H34O2S2/c1-5-6-7-8-9-10-14-20-21-15-13-19-16(18)11-12-17(2,3)4/h5-15H2,1-4H3 |
| InChIKey | KRYXIHNEUIPWLG-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.59 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|