C20H40OS2 — CID 164989398
1-(decyldisulfanyl)-7,7-dimethyloctan-4-one (PubChem CID 164989398) has the molecular formula C20H40OS2 and a molecular weight of 360.67 g/mol. Its IUPAC name is 1-(decyldisulfanyl)-7,7-dimethyloctan-4-one.
| Compound Name | 1-(decyldisulfanyl)-7,7-dimethyloctan-4-one |
|---|---|
| PubChem CID | 164989398 |
| Molecular Formula | C20H40OS2 |
| Molecular Weight | 360.67 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | 1-(decyldisulfanyl)-7,7-dimethyloctan-4-one |
| SMILES | CCCCCCCCCCSSCCCC(=O)CCC(C)(C)C |
| InChI | InChI=1S/C20H40OS2/c1-5-6-7-8-9-10-11-12-17-22-23-18-13-14-19(21)15-16-20(2,3)4/h5-18H2,1-4H3 |
| InChIKey | GFXRAKOZSMZQOY-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.67 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|