C20H38O2S — CID 139763884
8,8-dimethyl-1-nonylsulfanylnonane-2,4-dione (PubChem CID 139763884) has the molecular formula C20H38O2S and a molecular weight of 342.59 g/mol. Its IUPAC name is 8,8-dimethyl-1-nonylsulfanylnonane-2,4-dione.
| Compound Name | 8,8-dimethyl-1-nonylsulfanylnonane-2,4-dione |
|---|---|
| PubChem CID | 139763884 |
| Molecular Formula | C20H38O2S |
| Molecular Weight | 342.59 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | 8,8-dimethyl-1-nonylsulfanylnonane-2,4-dione |
| SMILES | CCCCCCCCCSCC(=O)CC(=O)CCCC(C)(C)C |
| InChI | InChI=1S/C20H38O2S/c1-5-6-7-8-9-10-11-15-23-17-19(22)16-18(21)13-12-14-20(2,3)4/h5-17H2,1-4H3 |
| InChIKey | HCKLHQGQHXXCAD-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.59 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|