2-(6-octylsulfanylhexylsulfanyl)acetic acid

C16H32O2S2 — CID 102095686

IUPAC2-(6-octylsulfanylhexylsulfanyl)acetic acid
SMILESCCCCCCCCSCCCCCCSCC(=O)O
InChIInChI=1S/C16H32O2S2/c1-2-3-4-5-6-9-12-19-13-10-7-8-11-14-20-15-16(17)18/h2-15H2,1H3,(H,17,18)
InChIKeyZFGHMHSPGBBWPB-UHFFFAOYSA-N
MW320.56 g/mol
LogP5.46
Rot. Bonds16

About 2-(6-octylsulfanylhexylsulfanyl)acetic acid

2-(6-octylsulfanylhexylsulfanyl)acetic acid (PubChem CID 102095686) has the molecular formula C16H32O2S2 and a molecular weight of 320.56 g/mol. Its IUPAC name is 2-(6-octylsulfanylhexylsulfanyl)acetic acid.

Molecular Properties

Compound Name2-(6-octylsulfanylhexylsulfanyl)acetic acid
PubChem CID102095686
Molecular FormulaC16H32O2S2
Molecular Weight320.56 g/mol
Exact Mass320.18
IUPAC Name2-(6-octylsulfanylhexylsulfanyl)acetic acid
SMILESCCCCCCCCSCCCCCCSCC(=O)O
InChIInChI=1S/C16H32O2S2/c1-2-3-4-5-6-9-12-19-13-10-7-8-11-14-20-15-16(17)18/h2-15H2,1H3,(H,17,18)
InChIKeyZFGHMHSPGBBWPB-UHFFFAOYSA-N
XLogP5.46
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds16
Heavy Atoms20
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500320.56
LogP ≤ 55.46
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-(6-octylsulfanylhexylsulfanyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(6-octylsulfanylhexylsulfanyl)acetic acid?
The IUPAC name of 2-(6-octylsulfanylhexylsulfanyl)acetic acid (CID 102095686) is 2-(6-octylsulfanylhexylsulfanyl)acetic acid.
What is the SMILES notation for 2-(6-octylsulfanylhexylsulfanyl)acetic acid?
The canonical SMILES for 2-(6-octylsulfanylhexylsulfanyl)acetic acid is CCCCCCCCSCCCCCCSCC(=O)O.
What is the InChIKey of 2-(6-octylsulfanylhexylsulfanyl)acetic acid?
The InChIKey is ZFGHMHSPGBBWPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O2S2/c1-2-3-4-5-6-9-12-19-13-10-7-8-11-14-20-15-16(17)18/h2-15H2,1H3,(H,17,18).
What are the key properties of 2-(6-octylsulfanylhexylsulfanyl)acetic acid?
2-(6-octylsulfanylhexylsulfanyl)acetic acid has a molecular weight of 320.56 g/mol, XLogP of 5.46, 16 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-octylsulfanylhexylsulfanyl)acetic acid is sourced from PubChem (CID 102095686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).